C18H17NO4S — CID 142769907
4-(5,5-dimethyl-4-oxo-2-phenylfuran-3-yl)benzenesulfonamide (PubChem CID 142769907) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is 4-(5,5-dimethyl-4-oxo-2-phenylfuran-3-yl)benzenesulfonamide.
| Compound Name | 4-(5,5-dimethyl-4-oxo-2-phenylfuran-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 142769907 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-(5,5-dimethyl-4-oxo-2-phenylfuran-3-yl)benzenesulfonamide |
| SMILES | CC1(C)OC(c2ccccc2)=C(c2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C18H17NO4S/c1-18(2)17(20)15(16(23-18)13-6-4-3-5-7-13)12-8-10-14(11-9-12)24(19,21)22/h3-11H,1-2H3,(H2,19,21,22) |
| InChIKey | HKNUMQXLNJHAOM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|