C20H18F2O4S — CID 16666105
3-(3,4-difluorophenyl)-5-ethyl-5-methyl-4-(4-methylsulfonylphenyl)furan-2-one (PubChem CID 16666105) has the molecular formula C20H18F2O4S and a molecular weight of 392.42 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-5-ethyl-5-methyl-4-(4-methylsulfonylphenyl)furan-2-one.
| Compound Name | 3-(3,4-difluorophenyl)-5-ethyl-5-methyl-4-(4-methylsulfonylphenyl)furan-2-one |
|---|---|
| PubChem CID | 16666105 |
| Molecular Formula | C20H18F2O4S |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 3-(3,4-difluorophenyl)-5-ethyl-5-methyl-4-(4-methylsulfonylphenyl)furan-2-one |
| SMILES | CCC1(C)OC(=O)C(c2ccc(F)c(F)c2)=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H18F2O4S/c1-4-20(2)18(12-5-8-14(9-6-12)27(3,24)25)17(19(23)26-20)13-7-10-15(21)16(22)11-13/h5-11H,4H2,1-3H3 |
| InChIKey | CCTOCAZCUXUVKE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|