C21H21FO5S — CID 21472745
3-(4-fluorophenyl)-5-methyl-4-(4-methylsulfonylphenyl)-5-propoxyfuran-2-one (PubChem CID 21472745) has the molecular formula C21H21FO5S and a molecular weight of 404.46 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-methyl-4-(4-methylsulfonylphenyl)-5-propoxyfuran-2-one.
| Compound Name | 3-(4-fluorophenyl)-5-methyl-4-(4-methylsulfonylphenyl)-5-propoxyfuran-2-one |
|---|---|
| PubChem CID | 21472745 |
| Molecular Formula | C21H21FO5S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 3-(4-fluorophenyl)-5-methyl-4-(4-methylsulfonylphenyl)-5-propoxyfuran-2-one |
| SMILES | CCCOC1(C)OC(=O)C(c2ccc(F)cc2)=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H21FO5S/c1-4-13-26-21(2)19(15-7-11-17(12-8-15)28(3,24)25)18(20(23)27-21)14-5-9-16(22)10-6-14/h5-12H,4,13H2,1-3H3 |
| InChIKey | WPNPNEUFPXWPFD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|