C19H16F2O5S — CID 21472758
3-(3,4-difluorophenyl)-5-methoxy-5-methyl-4-(4-methylsulfonylphenyl)furan-2-one (PubChem CID 21472758) has the molecular formula C19H16F2O5S and a molecular weight of 394.40 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-5-methoxy-5-methyl-4-(4-methylsulfonylphenyl)furan-2-one.
| Compound Name | 3-(3,4-difluorophenyl)-5-methoxy-5-methyl-4-(4-methylsulfonylphenyl)furan-2-one |
|---|---|
| PubChem CID | 21472758 |
| Molecular Formula | C19H16F2O5S |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 3-(3,4-difluorophenyl)-5-methoxy-5-methyl-4-(4-methylsulfonylphenyl)furan-2-one |
| SMILES | COC1(C)OC(=O)C(c2ccc(F)c(F)c2)=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H16F2O5S/c1-19(25-2)17(11-4-7-13(8-5-11)27(3,23)24)16(18(22)26-19)12-6-9-14(20)15(21)10-12/h4-10H,1-3H3 |
| InChIKey | UFSIAXJAQZLKJX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|