C20H20O4S — CID 22002642
5,5-dimethyl-3-(4-methylphenyl)-4-(4-methylsulfonylphenyl)furan-2-one (PubChem CID 22002642) has the molecular formula C20H20O4S and a molecular weight of 356.44 g/mol. Its IUPAC name is 5,5-dimethyl-3-(4-methylphenyl)-4-(4-methylsulfonylphenyl)furan-2-one.
| Compound Name | 5,5-dimethyl-3-(4-methylphenyl)-4-(4-methylsulfonylphenyl)furan-2-one |
|---|---|
| PubChem CID | 22002642 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 5,5-dimethyl-3-(4-methylphenyl)-4-(4-methylsulfonylphenyl)furan-2-one |
| SMILES | Cc1ccc(C2=C(c3ccc(S(C)(=O)=O)cc3)C(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C20H20O4S/c1-13-5-7-14(8-6-13)17-18(20(2,3)24-19(17)21)15-9-11-16(12-10-15)25(4,22)23/h5-12H,1-4H3 |
| InChIKey | QQUPUGZYBODBOR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|