C20H18ClFO4S — CID 18385917
4-(3-chloro-5-fluorophenyl)-2-ethyl-2-methyl-5-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 18385917) has the molecular formula C20H18ClFO4S and a molecular weight of 408.88 g/mol. Its IUPAC name is 4-(3-chloro-5-fluorophenyl)-2-ethyl-2-methyl-5-(4-methylsulfonylphenyl)furan-3-one.
| Compound Name | 4-(3-chloro-5-fluorophenyl)-2-ethyl-2-methyl-5-(4-methylsulfonylphenyl)furan-3-one |
|---|---|
| PubChem CID | 18385917 |
| Molecular Formula | C20H18ClFO4S |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 4-(3-chloro-5-fluorophenyl)-2-ethyl-2-methyl-5-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | CCC1(C)OC(c2ccc(S(C)(=O)=O)cc2)=C(c2cc(F)cc(Cl)c2)C1=O |
| InChI | InChI=1S/C20H18ClFO4S/c1-4-20(2)19(23)17(13-9-14(21)11-15(22)10-13)18(26-20)12-5-7-16(8-6-12)27(3,24)25/h5-11H,4H2,1-3H3 |
| InChIKey | YXEBHRCPJDPGCM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|