C19H16ClO4S- — CID 174385389
[2-chloro-4-(5,5-dimethyl-4-oxo-3-phenylfuran-2-yl)phenyl]methanesulfinate (PubChem CID 174385389) has the molecular formula C19H16ClO4S- and a molecular weight of 375.85 g/mol. Its IUPAC name is [2-chloro-4-(5,5-dimethyl-4-oxo-3-phenylfuran-2-yl)phenyl]methanesulfinate.
| Compound Name | [2-chloro-4-(5,5-dimethyl-4-oxo-3-phenylfuran-2-yl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174385389 |
| Molecular Formula | C19H16ClO4S- |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | [2-chloro-4-(5,5-dimethyl-4-oxo-3-phenylfuran-2-yl)phenyl]methanesulfinate |
| SMILES | CC1(C)OC(c2ccc(CS(=O)[O-])c(Cl)c2)=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H17ClO4S/c1-19(2)18(21)16(12-6-4-3-5-7-12)17(24-19)13-8-9-14(11-25(22)23)15(20)10-13/h3-10H,11H2,1-2H3,(H,22,23)/p-1 |
| InChIKey | KTRJPSWTMVRPSN-UHFFFAOYSA-M |
| XLogP | 3.97 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|