C20H17F3O4S — CID 174373860
[4-[5,5-dimethyl-4-oxo-3-[3-(trifluoromethyl)phenyl]furan-2-yl]phenyl]methanesulfinic acid (PubChem CID 174373860) has the molecular formula C20H17F3O4S and a molecular weight of 410.41 g/mol. Its IUPAC name is [4-[5,5-dimethyl-4-oxo-3-[3-(trifluoromethyl)phenyl]furan-2-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[5,5-dimethyl-4-oxo-3-[3-(trifluoromethyl)phenyl]furan-2-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174373860 |
| Molecular Formula | C20H17F3O4S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | [4-[5,5-dimethyl-4-oxo-3-[3-(trifluoromethyl)phenyl]furan-2-yl]phenyl]methanesulfinic acid |
| SMILES | CC1(C)OC(c2ccc(CS(=O)O)cc2)=C(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C20H17F3O4S/c1-19(2)18(24)16(14-4-3-5-15(10-14)20(21,22)23)17(27-19)13-8-6-12(7-9-13)11-28(25)26/h3-10H,11H2,1-2H3,(H,25,26) |
| InChIKey | JRQLUGBBNFOBRN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|