C18H14F3NO3 — CID 174863229
5-amino-2-(hydroxymethyl)-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3-one (PubChem CID 174863229) has the molecular formula C18H14F3NO3 and a molecular weight of 349.31 g/mol. Its IUPAC name is 5-amino-2-(hydroxymethyl)-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3-one.
| Compound Name | 5-amino-2-(hydroxymethyl)-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3-one |
|---|---|
| PubChem CID | 174863229 |
| Molecular Formula | C18H14F3NO3 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 5-amino-2-(hydroxymethyl)-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3-one |
| SMILES | NC1=C(c2cccc(C(F)(F)F)c2)C(=O)C(CO)(c2ccccc2)O1 |
| InChI | InChI=1S/C18H14F3NO3/c19-18(20,21)13-8-4-5-11(9-13)14-15(24)17(10-23,25-16(14)22)12-6-2-1-3-7-12/h1-9,23H,10,22H2 |
| InChIKey | LEEPTYSTYHAVLE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |