C16H16F3NO4 — CID 151304625
methyl 2-[5-amino-5-ethyl-4-oxo-3-[3-(trifluoromethyl)phenyl]furan-2-yl]acetate (PubChem CID 151304625) has the molecular formula C16H16F3NO4 and a molecular weight of 343.30 g/mol. Its IUPAC name is methyl 2-[5-amino-5-ethyl-4-oxo-3-[3-(trifluoromethyl)phenyl]furan-2-yl]acetate.
| Compound Name | methyl 2-[5-amino-5-ethyl-4-oxo-3-[3-(trifluoromethyl)phenyl]furan-2-yl]acetate |
|---|---|
| PubChem CID | 151304625 |
| Molecular Formula | C16H16F3NO4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | methyl 2-[5-amino-5-ethyl-4-oxo-3-[3-(trifluoromethyl)phenyl]furan-2-yl]acetate |
| SMILES | CCC1(N)OC(CC(=O)OC)=C(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C16H16F3NO4/c1-3-15(20)14(22)13(11(24-15)8-12(21)23-2)9-5-4-6-10(7-9)16(17,18)19/h4-7H,3,8,20H2,1-2H3 |
| InChIKey | ODDKEKOZNKFCBL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |