C13H11F4NO — CID 22153066
3-amino-5-(fluoromethyl)-2-[3-(trifluoromethyl)phenyl]cyclopent-2-en-1-one (PubChem CID 22153066) has the molecular formula C13H11F4NO and a molecular weight of 273.23 g/mol. Its IUPAC name is 3-amino-5-(fluoromethyl)-2-[3-(trifluoromethyl)phenyl]cyclopent-2-en-1-one.
| Compound Name | 3-amino-5-(fluoromethyl)-2-[3-(trifluoromethyl)phenyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 22153066 |
| Molecular Formula | C13H11F4NO |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-amino-5-(fluoromethyl)-2-[3-(trifluoromethyl)phenyl]cyclopent-2-en-1-one |
| SMILES | NC1=C(c2cccc(C(F)(F)F)c2)C(=O)C(CF)C1 |
| InChI | InChI=1S/C13H11F4NO/c14-6-8-5-10(18)11(12(8)19)7-2-1-3-9(4-7)13(15,16)17/h1-4,8H,5-6,18H2 |
| InChIKey | SYLQNKPCJAXUQH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |