C24H20F3NO — CID 22153157
3-(ethylamino)-5-naphthalen-1-yl-2-[3-(trifluoromethyl)phenyl]cyclopent-2-en-1-one (PubChem CID 22153157) has the molecular formula C24H20F3NO and a molecular weight of 395.42 g/mol. Its IUPAC name is 3-(ethylamino)-5-naphthalen-1-yl-2-[3-(trifluoromethyl)phenyl]cyclopent-2-en-1-one.
| Compound Name | 3-(ethylamino)-5-naphthalen-1-yl-2-[3-(trifluoromethyl)phenyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 22153157 |
| Molecular Formula | C24H20F3NO |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 3-(ethylamino)-5-naphthalen-1-yl-2-[3-(trifluoromethyl)phenyl]cyclopent-2-en-1-one |
| SMILES | CCNC1=C(c2cccc(C(F)(F)F)c2)C(=O)C(c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C24H20F3NO/c1-2-28-21-14-20(19-12-6-8-15-7-3-4-11-18(15)19)23(29)22(21)16-9-5-10-17(13-16)24(25,26)27/h3-13,20,28H,2,14H2,1H3 |
| InChIKey | GCHZZYOPBKOGIV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |