C27H24F3NO3 — CID 57088484
methyl 2-[[4-naphthalen-1-yl-3-oxo-2-[3-(trifluoromethyl)phenyl]cyclopentylidene]amino]butanoate (PubChem CID 57088484) has the molecular formula C27H24F3NO3 and a molecular weight of 467.49 g/mol. Its IUPAC name is methyl 2-[[4-naphthalen-1-yl-3-oxo-2-[3-(trifluoromethyl)phenyl]cyclopentylidene]amino]butanoate.
| Compound Name | methyl 2-[[4-naphthalen-1-yl-3-oxo-2-[3-(trifluoromethyl)phenyl]cyclopentylidene]amino]butanoate |
|---|---|
| PubChem CID | 57088484 |
| Molecular Formula | C27H24F3NO3 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | methyl 2-[[4-naphthalen-1-yl-3-oxo-2-[3-(trifluoromethyl)phenyl]cyclopentylidene]amino]butanoate |
| SMILES | CCC(/N=C1\CC(c2cccc3ccccc23)C(=O)C1c1cccc(C(F)(F)F)c1)C(=O)OC |
| InChI | InChI=1S/C27H24F3NO3/c1-3-22(26(33)34-2)31-23-15-21(20-13-7-9-16-8-4-5-12-19(16)20)25(32)24(23)17-10-6-11-18(14-17)27(28,29)30/h4-14,21-22,24H,3,15H2,1-2H3/b31-23+ |
| InChIKey | KXNZLJFLECMRLR-UQRQXUALSA-N |
| XLogP | 6.09 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|