C23H22F3NO3 — CID 57251375
methyl 2-[[3-oxo-4-phenyl-2-[3-(trifluoromethyl)phenyl]cyclopentylidene]amino]butanoate (PubChem CID 57251375) has the molecular formula C23H22F3NO3 and a molecular weight of 417.43 g/mol. Its IUPAC name is methyl 2-[[3-oxo-4-phenyl-2-[3-(trifluoromethyl)phenyl]cyclopentylidene]amino]butanoate.
| Compound Name | methyl 2-[[3-oxo-4-phenyl-2-[3-(trifluoromethyl)phenyl]cyclopentylidene]amino]butanoate |
|---|---|
| PubChem CID | 57251375 |
| Molecular Formula | C23H22F3NO3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | methyl 2-[[3-oxo-4-phenyl-2-[3-(trifluoromethyl)phenyl]cyclopentylidene]amino]butanoate |
| SMILES | CCC(/N=C1\CC(c2ccccc2)C(=O)C1c1cccc(C(F)(F)F)c1)C(=O)OC |
| InChI | InChI=1S/C23H22F3NO3/c1-3-18(22(29)30-2)27-19-13-17(14-8-5-4-6-9-14)21(28)20(19)15-10-7-11-16(12-15)23(24,25)26/h4-12,17-18,20H,3,13H2,1-2H3/b27-19+ |
| InChIKey | DITLDGYUTSNPGC-ZXVVBBHZSA-N |
| XLogP | 4.94 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|