C13H16F3NO2 — CID 115050962
methyl 2-amino-3-methyl-3-[3-(trifluoromethyl)phenyl]butanoate (PubChem CID 115050962) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is methyl 2-amino-3-methyl-3-[3-(trifluoromethyl)phenyl]butanoate.
| Compound Name | methyl 2-amino-3-methyl-3-[3-(trifluoromethyl)phenyl]butanoate |
|---|---|
| PubChem CID | 115050962 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | methyl 2-amino-3-methyl-3-[3-(trifluoromethyl)phenyl]butanoate |
| SMILES | COC(=O)C(N)C(C)(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO2/c1-12(2,10(17)11(18)19-3)8-5-4-6-9(7-8)13(14,15)16/h4-7,10H,17H2,1-3H3 |
| InChIKey | JVLDAYQIEHOPFA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |