C20H18F3NO3 — CID 164672807
tert-butyl 2-oxo-3-[3-(trifluoromethyl)phenyl]-3H-indole-1-carboxylate (PubChem CID 164672807) has the molecular formula C20H18F3NO3 and a molecular weight of 377.36 g/mol. Its IUPAC name is tert-butyl 2-oxo-3-[3-(trifluoromethyl)phenyl]-3H-indole-1-carboxylate.
| Compound Name | tert-butyl 2-oxo-3-[3-(trifluoromethyl)phenyl]-3H-indole-1-carboxylate |
|---|---|
| PubChem CID | 164672807 |
| Molecular Formula | C20H18F3NO3 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | tert-butyl 2-oxo-3-[3-(trifluoromethyl)phenyl]-3H-indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C(c2cccc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C20H18F3NO3/c1-19(2,3)27-18(26)24-15-10-5-4-9-14(15)16(17(24)25)12-7-6-8-13(11-12)20(21,22)23/h4-11,16H,1-3H3 |
| InChIKey | BONBVSLVACADCI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |