C23H18ClNO5 — CID 71739998
tert-butyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-oxo-3H-indole-1-carboxylate (PubChem CID 71739998) has the molecular formula C23H18ClNO5 and a molecular weight of 423.85 g/mol. Its IUPAC name is tert-butyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-oxo-3H-indole-1-carboxylate.
| Compound Name | tert-butyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-oxo-3H-indole-1-carboxylate |
|---|---|
| PubChem CID | 71739998 |
| Molecular Formula | C23H18ClNO5 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | tert-butyl 3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-oxo-3H-indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C(C2=C(Cl)C(=O)c3ccccc3C2=O)c2ccccc21 |
| InChI | InChI=1S/C23H18ClNO5/c1-23(2,3)30-22(29)25-15-11-7-6-10-14(15)16(21(25)28)17-18(24)20(27)13-9-5-4-8-12(13)19(17)26/h4-11,16H,1-3H3 |
| InChIKey | SXXHNHUQCFTENP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|