C21H21N3O7 — CID 73054951
tert-butyl (3R)-3-[(1S)-2-nitro-1-(4-nitrophenyl)ethyl]-2-oxo-3H-indole-1-carboxylate (PubChem CID 73054951) has the molecular formula C21H21N3O7 and a molecular weight of 427.41 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(1S)-2-nitro-1-(4-nitrophenyl)ethyl]-2-oxo-3H-indole-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(1S)-2-nitro-1-(4-nitrophenyl)ethyl]-2-oxo-3H-indole-1-carboxylate |
|---|---|
| PubChem CID | 73054951 |
| Molecular Formula | C21H21N3O7 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | tert-butyl (3R)-3-[(1S)-2-nitro-1-(4-nitrophenyl)ethyl]-2-oxo-3H-indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@H]([C@H](C[N+](=O)[O-])c2ccc([N+](=O)[O-])cc2)c2ccccc21 |
| InChI | InChI=1S/C21H21N3O7/c1-21(2,3)31-20(26)23-17-7-5-4-6-15(17)18(19(23)25)16(12-22(27)28)13-8-10-14(11-9-13)24(29)30/h4-11,16,18H,12H2,1-3H3/t16-,18+/m1/s1 |
| InChIKey | AGHDQKBOVQWGES-AEFFLSMTSA-N |
| XLogP | 4.02 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|