C14H14N2O8 — CID 56839893
2,2-dimethyl-5-[2-nitro-1-(4-nitrophenyl)ethyl]-1,3-dioxane-4,6-dione (PubChem CID 56839893) has the molecular formula C14H14N2O8 and a molecular weight of 338.27 g/mol. Its IUPAC name is 2,2-dimethyl-5-[2-nitro-1-(4-nitrophenyl)ethyl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[2-nitro-1-(4-nitrophenyl)ethyl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 56839893 |
| Molecular Formula | C14H14N2O8 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2,2-dimethyl-5-[2-nitro-1-(4-nitrophenyl)ethyl]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C(C[N+](=O)[O-])c2ccc([N+](=O)[O-])cc2)C(=O)O1 |
| InChI | InChI=1S/C14H14N2O8/c1-14(2)23-12(17)11(13(18)24-14)10(7-15(19)20)8-3-5-9(6-4-8)16(21)22/h3-6,10-11H,7H2,1-2H3 |
| InChIKey | VVVALIOFEBGACR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|