C9H7Br3N2O4 — CID 25270711
1-nitro-4-(1,1,1-tribromo-3-nitropropan-2-yl)benzene (PubChem CID 25270711) has the molecular formula C9H7Br3N2O4 and a molecular weight of 446.88 g/mol. Its IUPAC name is 1-nitro-4-(1,1,1-tribromo-3-nitropropan-2-yl)benzene.
| Compound Name | 1-nitro-4-(1,1,1-tribromo-3-nitropropan-2-yl)benzene |
|---|---|
| PubChem CID | 25270711 |
| Molecular Formula | C9H7Br3N2O4 |
| Molecular Weight | 446.88 g/mol |
| Exact Mass | 443.80 |
| IUPAC Name | 1-nitro-4-(1,1,1-tribromo-3-nitropropan-2-yl)benzene |
| SMILES | O=[N+]([O-])CC(c1ccc([N+](=O)[O-])cc1)C(Br)(Br)Br |
| InChI | InChI=1S/C9H7Br3N2O4/c10-9(11,12)8(5-13(15)16)6-1-3-7(4-2-6)14(17)18/h1-4,8H,5H2 |
| InChIKey | LGZVUONMHBYLAK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.88 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|