C50H34N4O8 — CID 164575801
1-(4-nitrophenyl)-4-[1,2,2-tris[4-(4-nitrophenyl)phenyl]ethyl]benzene (PubChem CID 164575801) has the molecular formula C50H34N4O8 and a molecular weight of 818.84 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-4-[1,2,2-tris[4-(4-nitrophenyl)phenyl]ethyl]benzene.
| Compound Name | 1-(4-nitrophenyl)-4-[1,2,2-tris[4-(4-nitrophenyl)phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 164575801 |
| Molecular Formula | C50H34N4O8 |
| Molecular Weight | 818.84 g/mol |
| Exact Mass | 818.24 |
| IUPAC Name | 1-(4-nitrophenyl)-4-[1,2,2-tris[4-(4-nitrophenyl)phenyl]ethyl]benzene |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(C(c3ccc(-c4ccc([N+](=O)[O-])cc4)cc3)C(c3ccc(-c4ccc([N+](=O)[O-])cc4)cc3)c3ccc(-c4ccc([N+](=O)[O-])cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C50H34N4O8/c55-51(56)45-25-17-37(18-26-45)33-1-9-41(10-2-33)49(42-11-3-34(4-12-42)38-19-27-46(28-20-38)52(57)58)50(43-13-5-35(6-14-43)39-21-29-47(30-22-39)53(59)60)44-15-7-36(8-16-44)40-23-31-48(32-24-40)54(61)62/h1-32,49-50H |
| InChIKey | SKHFMTODMNOWAN-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.84 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|