[nitrooxy-(4-nitrophenyl)methyl] nitrate

C7H5N3O8 — CID 15731305

IUPAC[nitrooxy-(4-nitrophenyl)methyl] nitrate
SMILESO=[N+]([O-])OC(O[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1
InChIInChI=1S/C7H5N3O8/c11-8(12)6-3-1-5(2-4-6)7(17-9(13)14)18-10(15)16/h1-4,7H
InChIKeyNCGLTONRIMWOAQ-UHFFFAOYSA-N
MW259.13 g/mol
LogP1.01
Rot. Bonds6

About [nitrooxy-(4-nitrophenyl)methyl] nitrate

[nitrooxy-(4-nitrophenyl)methyl] nitrate (PubChem CID 15731305) has the molecular formula C7H5N3O8 and a molecular weight of 259.13 g/mol. Its IUPAC name is [nitrooxy-(4-nitrophenyl)methyl] nitrate.

Molecular Properties

Compound Name[nitrooxy-(4-nitrophenyl)methyl] nitrate
PubChem CID15731305
Molecular FormulaC7H5N3O8
Molecular Weight259.13 g/mol
Exact Mass259.01
IUPAC Name[nitrooxy-(4-nitrophenyl)methyl] nitrate
SMILESO=[N+]([O-])OC(O[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1
InChIInChI=1S/C7H5N3O8/c11-8(12)6-3-1-5(2-4-6)7(17-9(13)14)18-10(15)16/h1-4,7H
InChIKeyNCGLTONRIMWOAQ-UHFFFAOYSA-N
XLogP1.01
TPSA147.88 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.13
LogP ≤ 51.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [nitrooxy-(4-nitrophenyl)methyl] nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [nitrooxy-(4-nitrophenyl)methyl] nitrate?
The IUPAC name of [nitrooxy-(4-nitrophenyl)methyl] nitrate (CID 15731305) is [nitrooxy-(4-nitrophenyl)methyl] nitrate.
What is the SMILES notation for [nitrooxy-(4-nitrophenyl)methyl] nitrate?
The canonical SMILES for [nitrooxy-(4-nitrophenyl)methyl] nitrate is O=[N+]([O-])OC(O[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [nitrooxy-(4-nitrophenyl)methyl] nitrate?
The InChIKey is NCGLTONRIMWOAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O8/c11-8(12)6-3-1-5(2-4-6)7(17-9(13)14)18-10(15)16/h1-4,7H.
What are the key properties of [nitrooxy-(4-nitrophenyl)methyl] nitrate?
[nitrooxy-(4-nitrophenyl)methyl] nitrate has a molecular weight of 259.13 g/mol, XLogP of 1.01, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [nitrooxy-(4-nitrophenyl)methyl] nitrate is sourced from PubChem (CID 15731305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).