C14H9Cl3N2O4 — CID 5102756
1-nitro-4-[2,2,2-trichloro-1-(4-nitrophenyl)ethyl]benzene (PubChem CID 5102756) has the molecular formula C14H9Cl3N2O4 and a molecular weight of 375.60 g/mol. Its IUPAC name is 1-nitro-4-[2,2,2-trichloro-1-(4-nitrophenyl)ethyl]benzene.
| Compound Name | 1-nitro-4-[2,2,2-trichloro-1-(4-nitrophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 5102756 |
| Molecular Formula | C14H9Cl3N2O4 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | 1-nitro-4-[2,2,2-trichloro-1-(4-nitrophenyl)ethyl]benzene |
| SMILES | O=[N+]([O-])c1ccc(C(c2ccc([N+](=O)[O-])cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H9Cl3N2O4/c15-14(16,17)13(9-1-5-11(6-2-9)18(20)21)10-3-7-12(8-4-10)19(22)23/h1-8,13H |
| InChIKey | LJRFNQXPBYFIKQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|