C11H15NO4 — CID 14941347
2,2-dimethyl-1-(4-nitrophenyl)propane-1,3-diol (PubChem CID 14941347) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2,2-dimethyl-1-(4-nitrophenyl)propane-1,3-diol.
| Compound Name | 2,2-dimethyl-1-(4-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 14941347 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2,2-dimethyl-1-(4-nitrophenyl)propane-1,3-diol |
| SMILES | CC(C)(CO)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H15NO4/c1-11(2,7-13)10(14)8-3-5-9(6-4-8)12(15)16/h3-6,10,13-14H,7H2,1-2H3 |
| InChIKey | POEKGFINPVXKMR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|