C13H19NO5 — CID 91158268
2,2-dimethyl-1-(4-nitrophenyl)pentane-1,3,5-triol (PubChem CID 91158268) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2,2-dimethyl-1-(4-nitrophenyl)pentane-1,3,5-triol.
| Compound Name | 2,2-dimethyl-1-(4-nitrophenyl)pentane-1,3,5-triol |
|---|---|
| PubChem CID | 91158268 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2,2-dimethyl-1-(4-nitrophenyl)pentane-1,3,5-triol |
| SMILES | CC(C)(C(O)CCO)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H19NO5/c1-13(2,11(16)7-8-15)12(17)9-3-5-10(6-4-9)14(18)19/h3-6,11-12,15-17H,7-8H2,1-2H3 |
| InChIKey | SHAHDTLPRAWUMW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|