C20H22N4O7S — CID 157028376
tert-butyl 3-[[(4-nitrophenyl)sulfonylamino]carbamoyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 157028376) has the molecular formula C20H22N4O7S and a molecular weight of 462.48 g/mol. Its IUPAC name is tert-butyl 3-[[(4-nitrophenyl)sulfonylamino]carbamoyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 3-[[(4-nitrophenyl)sulfonylamino]carbamoyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 157028376 |
| Molecular Formula | C20H22N4O7S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | tert-butyl 3-[[(4-nitrophenyl)sulfonylamino]carbamoyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(=O)NNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc21 |
| InChI | InChI=1S/C20H22N4O7S/c1-20(2,3)31-19(26)23-12-16(15-6-4-5-7-17(15)23)18(25)21-22-32(29,30)14-10-8-13(9-11-14)24(27)28/h4-11,16,22H,12H2,1-3H3,(H,21,25) |
| InChIKey | GPJMTWUAPMRVJH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|