C20H21FN2O3 — CID 146150613
tert-butyl 3-[(3-fluorophenyl)carbamoyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 146150613) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is tert-butyl 3-[(3-fluorophenyl)carbamoyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-fluorophenyl)carbamoyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 146150613 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | tert-butyl 3-[(3-fluorophenyl)carbamoyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(=O)Nc2cccc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C20H21FN2O3/c1-20(2,3)26-19(25)23-12-16(15-9-4-5-10-17(15)23)18(24)22-14-8-6-7-13(21)11-14/h4-11,16H,12H2,1-3H3,(H,22,24) |
| InChIKey | LPMFBUPPCWEGRG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |