C50H50Br2N4O14 — CID 139192606
tert-butyl (3E,4R)-3-[(4-bromophenyl)methylidene]-4-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]-2,5-dioxopyrrolidine-1-carboxylate (PubChem CID 139192606) has the molecular formula C50H50Br2N4O14 and a molecular weight of 1090.77 g/mol. Its IUPAC name is tert-butyl (3E,4R)-3-[(4-bromophenyl)methylidene]-4-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]-2,5-dioxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3E,4R)-3-[(4-bromophenyl)methylidene]-4-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]-2,5-dioxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139192606 |
| Molecular Formula | C50H50Br2N4O14 |
| Molecular Weight | 1090.77 g/mol |
| Exact Mass | 1088.17 |
| IUPAC Name | tert-butyl (3E,4R)-3-[(4-bromophenyl)methylidene]-4-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]-2,5-dioxopyrrolidine-1-carboxylate |
| SMILES | COc1ccc([C@@H](C[N+](=O)[O-])[C@H]2C(=O)N(C(=O)OC(C)(C)C)C(=O)/C2=C/c2ccc(Br)cc2)cc1.COc1ccc([C@@H](C[N+](=O)[O-])[C@H]2C(=O)N(C(=O)OC(C)(C)C)C(=O)/C2=C/c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/2C25H25BrN2O7/c2*1-25(2,3)35-24(31)28-22(29)19(13-15-5-9-17(26)10-6-15)21(23(28)30)20(14-27(32)33)16-7-11-18(34-4)12-8-16/h2*5-13,20-21H,14H2,1-4H3/b2*19-13+/t2*20-,21+/m11/s1 |
| InChIKey | CWQTVOVWYFNLDK-DOFHQSAHSA-N |
| XLogP | 9.64 |
| TPSA | 232.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1090.77 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|