C24H26N2O5 — CID 132599832
tert-butyl 2-[(R)-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-(4-nitrophenyl)methyl]prop-2-enoate (PubChem CID 132599832) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is tert-butyl 2-[(R)-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-(4-nitrophenyl)methyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[(R)-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-(4-nitrophenyl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 132599832 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | tert-butyl 2-[(R)-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-(4-nitrophenyl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(C)C)[C@H](c1ccc([N+](=O)[O-])cc1)[C@@]1(C)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C24H26N2O5/c1-15(21(27)31-23(2,3)4)20(16-11-13-17(14-12-16)26(29)30)24(5)18-9-7-8-10-19(18)25(6)22(24)28/h7-14,20H,1H2,2-6H3/t20-,24+/m1/s1 |
| InChIKey | PQMIYGFDIFCOME-YKSBVNFPSA-N |
| XLogP | 4.51 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|