C22H18N2O6 — CID 132580974
methyl (1R,6R)-1'-methyl-3-(4-nitrophenyl)-2',5-dioxospiro[cyclohex-3-ene-6,3'-indole]-1-carboxylate (PubChem CID 132580974) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is methyl (1R,6R)-1'-methyl-3-(4-nitrophenyl)-2',5-dioxospiro[cyclohex-3-ene-6,3'-indole]-1-carboxylate.
| Compound Name | methyl (1R,6R)-1'-methyl-3-(4-nitrophenyl)-2',5-dioxospiro[cyclohex-3-ene-6,3'-indole]-1-carboxylate |
|---|---|
| PubChem CID | 132580974 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | methyl (1R,6R)-1'-methyl-3-(4-nitrophenyl)-2',5-dioxospiro[cyclohex-3-ene-6,3'-indole]-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(c2ccc([N+](=O)[O-])cc2)=CC(=O)[C@@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C22H18N2O6/c1-23-18-6-4-3-5-16(18)22(21(23)27)17(20(26)30-2)11-14(12-19(22)25)13-7-9-15(10-8-13)24(28)29/h3-10,12,17H,11H2,1-2H3/t17-,22-/m0/s1 |
| InChIKey | JVYHHKBTUCGKRZ-JTSKRJEESA-N |
| XLogP | 2.65 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|