C20H17NO5 — CID 132580985
methyl (1R,6R)-3-(furan-2-yl)-1'-methyl-2',5-dioxospiro[cyclohex-3-ene-6,3'-indole]-1-carboxylate (PubChem CID 132580985) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is methyl (1R,6R)-3-(furan-2-yl)-1'-methyl-2',5-dioxospiro[cyclohex-3-ene-6,3'-indole]-1-carboxylate.
| Compound Name | methyl (1R,6R)-3-(furan-2-yl)-1'-methyl-2',5-dioxospiro[cyclohex-3-ene-6,3'-indole]-1-carboxylate |
|---|---|
| PubChem CID | 132580985 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | methyl (1R,6R)-3-(furan-2-yl)-1'-methyl-2',5-dioxospiro[cyclohex-3-ene-6,3'-indole]-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(c2ccco2)=CC(=O)[C@@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C20H17NO5/c1-21-15-7-4-3-6-13(15)20(19(21)24)14(18(23)25-2)10-12(11-17(20)22)16-8-5-9-26-16/h3-9,11,14H,10H2,1-2H3/t14-,20-/m0/s1 |
| InChIKey | NVAJHNXIAAZNJH-XOBRGWDASA-N |
| XLogP | 2.34 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|