C22H18ClNO4 — CID 132580980
methyl (1R,6R)-3-(2-chlorophenyl)-1'-methyl-2',5-dioxospiro[cyclohex-3-ene-6,3'-indole]-1-carboxylate (PubChem CID 132580980) has the molecular formula C22H18ClNO4 and a molecular weight of 395.84 g/mol. Its IUPAC name is methyl (1R,6R)-3-(2-chlorophenyl)-1'-methyl-2',5-dioxospiro[cyclohex-3-ene-6,3'-indole]-1-carboxylate.
| Compound Name | methyl (1R,6R)-3-(2-chlorophenyl)-1'-methyl-2',5-dioxospiro[cyclohex-3-ene-6,3'-indole]-1-carboxylate |
|---|---|
| PubChem CID | 132580980 |
| Molecular Formula | C22H18ClNO4 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | methyl (1R,6R)-3-(2-chlorophenyl)-1'-methyl-2',5-dioxospiro[cyclohex-3-ene-6,3'-indole]-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(c2ccccc2Cl)=CC(=O)[C@@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C22H18ClNO4/c1-24-18-10-6-4-8-15(18)22(21(24)27)16(20(26)28-2)11-13(12-19(22)25)14-7-3-5-9-17(14)23/h3-10,12,16H,11H2,1-2H3/t16-,22-/m0/s1 |
| InChIKey | LEJVBDXRLXNOCV-AOMKIAJQSA-N |
| XLogP | 3.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|