C30H24F3NO5 — CID 156787402
methyl (2R,3R,4S,4aR,9aR)-4a-hydroxy-1'-methyl-2',9-dioxo-3-phenyl-9a-(trifluoromethyl)spiro[3,4-dihydro-1H-fluorene-2,3'-indole]-4-carboxylate (PubChem CID 156787402) has the molecular formula C30H24F3NO5 and a molecular weight of 535.52 g/mol. Its IUPAC name is methyl (2R,3R,4S,4aR,9aR)-4a-hydroxy-1'-methyl-2',9-dioxo-3-phenyl-9a-(trifluoromethyl)spiro[3,4-dihydro-1H-fluorene-2,3'-indole]-4-carboxylate.
| Compound Name | methyl (2R,3R,4S,4aR,9aR)-4a-hydroxy-1'-methyl-2',9-dioxo-3-phenyl-9a-(trifluoromethyl)spiro[3,4-dihydro-1H-fluorene-2,3'-indole]-4-carboxylate |
|---|---|
| PubChem CID | 156787402 |
| Molecular Formula | C30H24F3NO5 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | methyl (2R,3R,4S,4aR,9aR)-4a-hydroxy-1'-methyl-2',9-dioxo-3-phenyl-9a-(trifluoromethyl)spiro[3,4-dihydro-1H-fluorene-2,3'-indole]-4-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2ccccc2)[C@@]2(C[C@]3(C(F)(F)F)C(=O)c4ccccc4[C@]13O)C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C30H24F3NO5/c1-34-21-15-9-8-14-20(21)27(26(34)37)16-28(30(31,32)33)24(35)18-12-6-7-13-19(18)29(28,38)23(25(36)39-2)22(27)17-10-4-3-5-11-17/h3-15,22-23,38H,16H2,1-2H3/t22-,23+,27-,28-,29-/m0/s1 |
| InChIKey | SXWORBIVQBJADS-AJRHGHNLSA-N |
| XLogP | 4.51 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |