C21H24N2O3 — CID 102116997
methyl (1R,3S,5S,6S,9Z)-9-ethylidene-1'-methyl-2'-oxospiro[7-azatricyclo[4.3.1.03,7]decane-5,3'-indole]-2-carboxylate (PubChem CID 102116997) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is methyl (1R,3S,5S,6S,9Z)-9-ethylidene-1'-methyl-2'-oxospiro[7-azatricyclo[4.3.1.03,7]decane-5,3'-indole]-2-carboxylate.
| Compound Name | methyl (1R,3S,5S,6S,9Z)-9-ethylidene-1'-methyl-2'-oxospiro[7-azatricyclo[4.3.1.03,7]decane-5,3'-indole]-2-carboxylate |
|---|---|
| PubChem CID | 102116997 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | methyl (1R,3S,5S,6S,9Z)-9-ethylidene-1'-methyl-2'-oxospiro[7-azatricyclo[4.3.1.03,7]decane-5,3'-indole]-2-carboxylate |
| SMILES | C/C=C1\CN2[C@H]3C[C@@H]1C(C(=O)OC)[C@@H]2C[C@@]31C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C21H24N2O3/c1-4-12-11-23-16-10-21(17(23)9-13(12)18(16)19(24)26-3)14-7-5-6-8-15(14)22(2)20(21)25/h4-8,13,16-18H,9-11H2,1-3H3/b12-4+/t13-,16-,17-,18?,21-/m0/s1 |
| InChIKey | LPMASMRAEMCPFQ-OWGNUHBJSA-N |
| XLogP | 2.11 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|