C20H24N2O2 — CID 162917448
(1R,2S,3S,5S,6S,9Z)-9-ethylidene-2-(hydroxymethyl)-1'-methylspiro[7-azatricyclo[4.3.1.03,7]decane-5,3'-indole]-2'-one (PubChem CID 162917448) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (1R,2S,3S,5S,6S,9Z)-9-ethylidene-2-(hydroxymethyl)-1'-methylspiro[7-azatricyclo[4.3.1.03,7]decane-5,3'-indole]-2'-one.
| Compound Name | (1R,2S,3S,5S,6S,9Z)-9-ethylidene-2-(hydroxymethyl)-1'-methylspiro[7-azatricyclo[4.3.1.03,7]decane-5,3'-indole]-2'-one |
|---|---|
| PubChem CID | 162917448 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (1R,2S,3S,5S,6S,9Z)-9-ethylidene-2-(hydroxymethyl)-1'-methylspiro[7-azatricyclo[4.3.1.03,7]decane-5,3'-indole]-2'-one |
| SMILES | C/C=C1\CN2[C@H]3C[C@@H]1[C@H](CO)[C@@H]2C[C@@]31C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C20H24N2O2/c1-3-12-10-22-17-9-20(18(22)8-13(12)14(17)11-23)15-6-4-5-7-16(15)21(2)19(20)24/h3-7,13-14,17-18,23H,8-11H2,1-2H3/b12-3+/t13-,14-,17-,18-,20-/m0/s1 |
| InChIKey | RCIQQZVEOPKKID-AXSCSNIDSA-N |
| XLogP | 1.93 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|