C19H22N2O2 — CID 162967930
(1'S,2S,3'S,6'S,9'Z)-9'-ethylidene-2'-(hydroxymethyl)spiro[1H-indole-2,5'-7-azatricyclo[4.3.1.03,7]decane]-3-one (PubChem CID 162967930) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (1'S,2S,3'S,6'S,9'Z)-9'-ethylidene-2'-(hydroxymethyl)spiro[1H-indole-2,5'-7-azatricyclo[4.3.1.03,7]decane]-3-one.
| Compound Name | (1'S,2S,3'S,6'S,9'Z)-9'-ethylidene-2'-(hydroxymethyl)spiro[1H-indole-2,5'-7-azatricyclo[4.3.1.03,7]decane]-3-one |
|---|---|
| PubChem CID | 162967930 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (1'S,2S,3'S,6'S,9'Z)-9'-ethylidene-2'-(hydroxymethyl)spiro[1H-indole-2,5'-7-azatricyclo[4.3.1.03,7]decane]-3-one |
| SMILES | C/C=C1\CN2[C@H]3C[C@H]1C(CO)[C@@H]2C[C@]31Nc2ccccc2C1=O |
| InChI | InChI=1S/C19H22N2O2/c1-2-11-9-21-16-8-19(17(21)7-13(11)14(16)10-22)18(23)12-5-3-4-6-15(12)20-19/h2-6,13-14,16-17,20,22H,7-10H2,1H3/b11-2+/t13-,14?,16+,17+,19+/m1/s1 |
| InChIKey | LQTOLYYQLWIGMJ-CICPHUBXSA-N |
| XLogP | 2.06 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|