C22H30N2O2 — CID 100990107
(9S,10R,11R,12Z)-8-ethyl-12-ethylidene-10-(hydroxymethyl)-14-methyl-8,14-diazatetracyclo[9.5.2.01,9.02,7]octadeca-2,4,6-trien-17-one (PubChem CID 100990107) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is (9S,10R,11R,12Z)-8-ethyl-12-ethylidene-10-(hydroxymethyl)-14-methyl-8,14-diazatetracyclo[9.5.2.01,9.02,7]octadeca-2,4,6-trien-17-one.
| Compound Name | (9S,10R,11R,12Z)-8-ethyl-12-ethylidene-10-(hydroxymethyl)-14-methyl-8,14-diazatetracyclo[9.5.2.01,9.02,7]octadeca-2,4,6-trien-17-one |
|---|---|
| PubChem CID | 100990107 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | (9S,10R,11R,12Z)-8-ethyl-12-ethylidene-10-(hydroxymethyl)-14-methyl-8,14-diazatetracyclo[9.5.2.01,9.02,7]octadeca-2,4,6-trien-17-one |
| SMILES | C/C=C1\CN(C)CCC23C(=O)C[C@@H]1[C@@H](CO)[C@@H]2N(CC)c1ccccc13 |
| InChI | InChI=1S/C22H30N2O2/c1-4-15-13-23(3)11-10-22-18-8-6-7-9-19(18)24(5-2)21(22)17(14-25)16(15)12-20(22)26/h4,6-9,16-17,21,25H,5,10-14H2,1-3H3/b15-4+/t16-,17+,21-,22?/m0/s1 |
| InChIKey | VFLFRGGUKLQVMU-BBOWCOHCSA-N |
| XLogP | 2.61 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|