C16H13NO3 — CID 2784777
3-hydroxy-1-methyl-3-phenylquinoline-2,4-dione (PubChem CID 2784777) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is 3-hydroxy-1-methyl-3-phenylquinoline-2,4-dione.
| Compound Name | 3-hydroxy-1-methyl-3-phenylquinoline-2,4-dione |
|---|---|
| PubChem CID | 2784777 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 3-hydroxy-1-methyl-3-phenylquinoline-2,4-dione |
| SMILES | CN1C(=O)C(O)(c2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H13NO3/c1-17-13-10-6-5-9-12(13)14(18)16(20,15(17)19)11-7-3-2-4-8-11/h2-10,20H,1H3 |
| InChIKey | HNZCOBZJMGJBRW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|