C21H15NO3 — CID 2784001
3-hydroxy-1,3-diphenylquinoline-2,4-dione (PubChem CID 2784001) has the molecular formula C21H15NO3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-hydroxy-1,3-diphenylquinoline-2,4-dione.
| Compound Name | 3-hydroxy-1,3-diphenylquinoline-2,4-dione |
|---|---|
| PubChem CID | 2784001 |
| Molecular Formula | C21H15NO3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-hydroxy-1,3-diphenylquinoline-2,4-dione |
| SMILES | O=C1c2ccccc2N(c2ccccc2)C(=O)C1(O)c1ccccc1 |
| InChI | InChI=1S/C21H15NO3/c23-19-17-13-7-8-14-18(17)22(16-11-5-2-6-12-16)20(24)21(19,25)15-9-3-1-4-10-15/h1-14,25H |
| InChIKey | WLHCHYBWLVNEOP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|