C21H15NOS — CID 165357462
1,3,3-triphenyl-4-sulfanylideneazetidin-2-one (PubChem CID 165357462) has the molecular formula C21H15NOS and a molecular weight of 329.42 g/mol. Its IUPAC name is 1,3,3-triphenyl-4-sulfanylideneazetidin-2-one.
| Compound Name | 1,3,3-triphenyl-4-sulfanylideneazetidin-2-one |
|---|---|
| PubChem CID | 165357462 |
| Molecular Formula | C21H15NOS |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1,3,3-triphenyl-4-sulfanylideneazetidin-2-one |
| SMILES | O=C1N(c2ccccc2)C(=S)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15NOS/c23-19-21(16-10-4-1-5-11-16,17-12-6-2-7-13-17)20(24)22(19)18-14-8-3-9-15-18/h1-15H |
| InChIKey | VIDVEFUNUPVBNY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|