About 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one
5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 134917365) has the molecular formula C23H19NO2S
and a molecular weight of 373.48 g/mol. Its IUPAC name is 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one.
Molecular Properties
| Compound Name | 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one |
| PubChem CID | 134917365 |
| Molecular Formula | C23H19NO2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | O=C1N(c2ccccc2)C(=S)OC1(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H19NO2S/c25-21-23(16-18-10-4-1-5-11-18,17-19-12-6-2-7-13-19)26-22(27)24(21)20-14-8-3-9-15-20/h1-15H,16-17H2 |
| InChIKey | JOTMTXJGNWIRHT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one?
The IUPAC name of 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one (CID 134917365) is 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one.
What is the SMILES notation for 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one?
The canonical SMILES for 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one is O=C1N(c2ccccc2)C(=S)OC1(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one?
The InChIKey is JOTMTXJGNWIRHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO2S/c25-21-23(16-18-10-4-1-5-11-18,17-19-12-6-2-7-13-19)26-22(27)24(21)20-14-8-3-9-15-20/h1-15H,16-17H2.
What are the key properties of 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one?
5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one has a molecular weight of 373.48 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one is sourced from PubChem (CID 134917365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).