C23H19NO2S — CID 134917365
5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 134917365) has the molecular formula C23H19NO2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one.
| Compound Name | 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 134917365 |
| Molecular Formula | C23H19NO2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 5,5-dibenzyl-3-phenyl-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | O=C1N(c2ccccc2)C(=S)OC1(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H19NO2S/c25-21-23(16-18-10-4-1-5-11-18,17-19-12-6-2-7-13-19)26-22(27)24(21)20-14-8-3-9-15-20/h1-15H,16-17H2 |
| InChIKey | JOTMTXJGNWIRHT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|