C25H19NO3 — CID 11188200
(1R,5S)-1-benzyl-3,7-diphenyl-3-azabicyclo[3.1.1]heptane-2,4,6-trione (PubChem CID 11188200) has the molecular formula C25H19NO3 and a molecular weight of 381.43 g/mol. Its IUPAC name is (1R,5S)-1-benzyl-3,7-diphenyl-3-azabicyclo[3.1.1]heptane-2,4,6-trione.
| Compound Name | (1R,5S)-1-benzyl-3,7-diphenyl-3-azabicyclo[3.1.1]heptane-2,4,6-trione |
|---|---|
| PubChem CID | 11188200 |
| Molecular Formula | C25H19NO3 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (1R,5S)-1-benzyl-3,7-diphenyl-3-azabicyclo[3.1.1]heptane-2,4,6-trione |
| SMILES | O=C1[C@@H]2C(=O)[C@](Cc3ccccc3)(C(=O)N1c1ccccc1)C2c1ccccc1 |
| InChI | InChI=1S/C25H19NO3/c27-22-20-21(18-12-6-2-7-13-18)25(22,16-17-10-4-1-5-11-17)24(29)26(23(20)28)19-14-8-3-9-15-19/h1-15,20-21H,16H2/t20-,21?,25+/m0/s1 |
| InChIKey | YXFHXIODNBHWRI-FXVCHHALSA-N |
| XLogP | 3.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|