C39H29N3O4 — CID 2786314
1-benzyl-4,7,8,11-tetraphenyl-4,8,11-triazatricyclo[5.2.2.02,6]undecane-3,5,9,10-tetrone (PubChem CID 2786314) has the molecular formula C39H29N3O4 and a molecular weight of 603.68 g/mol. Its IUPAC name is 1-benzyl-4,7,8,11-tetraphenyl-4,8,11-triazatricyclo[5.2.2.02,6]undecane-3,5,9,10-tetrone.
| Compound Name | 1-benzyl-4,7,8,11-tetraphenyl-4,8,11-triazatricyclo[5.2.2.02,6]undecane-3,5,9,10-tetrone |
|---|---|
| PubChem CID | 2786314 |
| Molecular Formula | C39H29N3O4 |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | 1-benzyl-4,7,8,11-tetraphenyl-4,8,11-triazatricyclo[5.2.2.02,6]undecane-3,5,9,10-tetrone |
| SMILES | O=C1C2C(C(=O)N1c1ccccc1)C1(c3ccccc3)N(c3ccccc3)C(=O)C2(Cc2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C39H29N3O4/c43-34-32-33(35(44)40(34)29-20-10-3-11-21-29)39(28-18-8-2-9-19-28)41(30-22-12-4-13-23-30)36(45)38(32,26-27-16-6-1-7-17-27)37(46)42(39)31-24-14-5-15-25-31/h1-25,32-33H,26H2 |
| InChIKey | UIMLPSAPRXHPPY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|