C15H7Cl6NO2 — CID 124677661
(1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 124677661) has the molecular formula C15H7Cl6NO2 and a molecular weight of 445.94 g/mol. Its IUPAC name is (1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 124677661 |
| Molecular Formula | C15H7Cl6NO2 |
| Molecular Weight | 445.94 g/mol |
| Exact Mass | 442.86 |
| IUPAC Name | (1R,2R,6R,7R)-1,7,8,9,10,10-hexachloro-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1c1ccccc1)[C@@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C15H7Cl6NO2/c16-9-10(17)14(19)8-7(13(9,18)15(14,20)21)11(23)22(12(8)24)6-4-2-1-3-5-6/h1-5,7-8H/t7-,8-,13-,14-/m1/s1 |
| InChIKey | FVJNTGADSRRIBS-VAXLJCBTSA-N |
| XLogP | 4.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.94 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|