C16H10Cl5NO2 — CID 10693680
(1S,2R,6S,7R)-1,7,8,9,10-pentachloro-10-methyl-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 10693680) has the molecular formula C16H10Cl5NO2 and a molecular weight of 425.53 g/mol. Its IUPAC name is (1S,2R,6S,7R)-1,7,8,9,10-pentachloro-10-methyl-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-1,7,8,9,10-pentachloro-10-methyl-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 10693680 |
| Molecular Formula | C16H10Cl5NO2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 422.92 |
| IUPAC Name | (1S,2R,6S,7R)-1,7,8,9,10-pentachloro-10-methyl-4-phenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC1(Cl)[C@@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C16H10Cl5NO2/c1-14(19)15(20)8-9(16(14,21)11(18)10(15)17)13(24)22(12(8)23)7-5-3-2-4-6-7/h2-6,8-9H,1H3/t8-,9+,14?,15+,16- |
| InChIKey | XLFHGUMEQZQQNH-FJEJIVBKSA-N |
| XLogP | 4.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|