C15H6BrCl6NO2 — CID 98527760
(1S,2R,6S,7S)-4-(4-bromophenyl)-1,7,8,9,10,10-hexachloro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98527760) has the molecular formula C15H6BrCl6NO2 and a molecular weight of 524.84 g/mol. Its IUPAC name is (1S,2R,6S,7S)-4-(4-bromophenyl)-1,7,8,9,10,10-hexachloro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7S)-4-(4-bromophenyl)-1,7,8,9,10,10-hexachloro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98527760 |
| Molecular Formula | C15H6BrCl6NO2 |
| Molecular Weight | 524.84 g/mol |
| Exact Mass | 520.77 |
| IUPAC Name | (1S,2R,6S,7S)-4-(4-bromophenyl)-1,7,8,9,10,10-hexachloro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccc(Br)cc1)[C@]1(Cl)C(Cl)=C(Cl)[C@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C15H6BrCl6NO2/c16-5-1-3-6(4-2-5)23-11(24)7-8(12(23)25)14(20)10(18)9(17)13(7,19)15(14,21)22/h1-4,7-8H/t7-,8+,13-,14-/m0/s1 |
| InChIKey | RCJXQMWSSUKLKE-NVIQENEESA-N |
| XLogP | 5.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.84 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|