C20H12BrCl6NO2 — CID 98153388
(1R,2R,3S,6S,7R,8S,9S,13R)-11-(4-bromophenyl)-3,4,5,6,15,15-hexachloro-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione (PubChem CID 98153388) has the molecular formula C20H12BrCl6NO2 and a molecular weight of 590.94 g/mol. Its IUPAC name is (1R,2R,3S,6S,7R,8S,9S,13R)-11-(4-bromophenyl)-3,4,5,6,15,15-hexachloro-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione.
| Compound Name | (1R,2R,3S,6S,7R,8S,9S,13R)-11-(4-bromophenyl)-3,4,5,6,15,15-hexachloro-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
|---|---|
| PubChem CID | 98153388 |
| Molecular Formula | C20H12BrCl6NO2 |
| Molecular Weight | 590.94 g/mol |
| Exact Mass | 586.82 |
| IUPAC Name | (1R,2R,3S,6S,7R,8S,9S,13R)-11-(4-bromophenyl)-3,4,5,6,15,15-hexachloro-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@@H]([C@@H]2C(=O)N1c1ccc(Br)cc1)[C@@H]1[C@@H]3[C@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C20H12BrCl6NO2/c21-6-1-3-7(4-2-6)28-16(29)10-8-5-9(11(10)17(28)30)13-12(8)18(24)14(22)15(23)19(13,25)20(18,26)27/h1-4,8-13H,5H2/t8-,9+,10-,11+,12-,13-,18+,19+/m1/s1 |
| InChIKey | NKAJGRIBVLLZNF-HDMRARPLSA-N |
| XLogP | 6.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.94 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|