C15H11Br3ClNO2 — CID 124717766
(1R,2S,6R,7R,8S,9R)-8,9-dibromo-4-(4-bromo-3-chlorophenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 124717766) has the molecular formula C15H11Br3ClNO2 and a molecular weight of 512.42 g/mol. Its IUPAC name is (1R,2S,6R,7R,8S,9R)-8,9-dibromo-4-(4-bromo-3-chlorophenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7R,8S,9R)-8,9-dibromo-4-(4-bromo-3-chlorophenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 124717766 |
| Molecular Formula | C15H11Br3ClNO2 |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 508.80 |
| IUPAC Name | (1R,2S,6R,7R,8S,9R)-8,9-dibromo-4-(4-bromo-3-chlorophenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@@H]([C@H](Br)[C@@H]3Br)[C@@H]2C(=O)N1c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C15H11Br3ClNO2/c16-8-2-1-5(3-9(8)19)20-14(21)10-6-4-7(11(10)15(20)22)13(18)12(6)17/h1-3,6-7,10-13H,4H2/t6-,7-,10-,11+,12-,13+/m1/s1 |
| InChIKey | YPBQVMMYUJXIIL-ZNOWBECESA-N |
| XLogP | 4.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|