C16H12Br2ClNO4 — CID 100807249
2-chloro-5-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoic acid (PubChem CID 100807249) has the molecular formula C16H12Br2ClNO4 and a molecular weight of 477.54 g/mol. Its IUPAC name is 2-chloro-5-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoic acid.
| Compound Name | 2-chloro-5-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoic acid |
|---|---|
| PubChem CID | 100807249 |
| Molecular Formula | C16H12Br2ClNO4 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 474.88 |
| IUPAC Name | 2-chloro-5-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)[C@H]3[C@@H]4C[C@@H]([C@@H](Br)[C@@H]4Br)[C@@H]3C2=O)ccc1Cl |
| InChI | InChI=1S/C16H12Br2ClNO4/c17-12-7-4-8(13(12)18)11-10(7)14(21)20(15(11)22)5-1-2-9(19)6(3-5)16(23)24/h1-3,7-8,10-13H,4H2,(H,23,24)/t7-,8+,10-,11-,12+,13+/m0/s1 |
| InChIKey | AIFPQPZOOAEVOZ-DQYLABDYSA-N |
| XLogP | 3.32 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|