C15H10ClNO5 — CID 99733065
5-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-chlorobenzoic acid (PubChem CID 99733065) has the molecular formula C15H10ClNO5 and a molecular weight of 319.70 g/mol. Its IUPAC name is 5-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-chlorobenzoic acid.
| Compound Name | 5-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 99733065 |
| Molecular Formula | C15H10ClNO5 |
| Molecular Weight | 319.70 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 5-[(3aR,4R,7R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3O2)ccc1Cl |
| InChI | InChI=1S/C15H10ClNO5/c16-8-2-1-6(5-7(8)15(20)21)17-13(18)11-9-3-4-10(22-9)12(11)14(17)19/h1-5,9-12H,(H,20,21)/t9-,10-,11-,12+/m1/s1 |
| InChIKey | MEUJYCDUNRJSPF-KKOKHZNYSA-N |
| XLogP | 1.48 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.70 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|